C12H20F3N — CID 123240234
(E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hept-4-en-3-imine (PubChem CID 123240234) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is (E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hept-4-en-3-imine.
| Compound Name | (E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hept-4-en-3-imine |
|---|---|
| PubChem CID | 123240234 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | (E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hept-4-en-3-imine |
| SMILES | CCC(/C=C(\C)C(C)(C)C)=N\CC(F)(F)F |
| InChI | InChI=1S/C12H20F3N/c1-6-10(16-8-12(13,14)15)7-9(2)11(3,4)5/h7H,6,8H2,1-5H3/b9-7+,16-10+ |
| InChIKey | UCARQPDFROVXNW-QCPPYIPPSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|