C11H18F3N — CID 89153658
(E)-1,1,1-trifluoro-N,3,4,5,5-pentamethylhex-3-en-2-imine (PubChem CID 89153658) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-N,3,4,5,5-pentamethylhex-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-N,3,4,5,5-pentamethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 89153658 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (E)-1,1,1-trifluoro-N,3,4,5,5-pentamethylhex-3-en-2-imine |
| SMILES | C/N=C(C(/C)=C(\C)C(C)(C)C)\C(F)(F)F |
| InChI | InChI=1S/C11H18F3N/c1-7(8(2)10(3,4)5)9(15-6)11(12,13)14/h1-6H3/b8-7+,15-9- |
| InChIKey | VPCJHWTVDMOBRH-YMOMHROCSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|