About butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine
butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine (PubChem CID 178040622) has the molecular formula C11H20F3N
and a molecular weight of 223.28 g/mol. Its IUPAC name is butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine.
Molecular Properties
| Compound Name | butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine |
| PubChem CID | 178040622 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine |
| SMILES | C/C=C(C(\C)=N\C)/C(F)(F)F.CCCC |
| InChI | InChI=1S/C7H10F3N.C4H10/c1-4-6(5(2)11-3)7(8,9)10;1-3-4-2/h4H,1-3H3;3-4H2,1-2H3/b6-4+,11-5+; |
| InChIKey | MQBMNUHBQJCOQN-SYEVNBJJSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine?
The IUPAC name of butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine (CID 178040622) is butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine.
What is the SMILES notation for butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine?
The canonical SMILES for butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine is C/C=C(C(\C)=N\C)/C(F)(F)F.CCCC.
What is the InChIKey of butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine?
The InChIKey is MQBMNUHBQJCOQN-SYEVNBJJSA-N. The full InChI is InChI=1S/C7H10F3N.C4H10/c1-4-6(5(2)11-3)7(8,9)10;1-3-4-2/h4H,1-3H3;3-4H2,1-2H3/b6-4+,11-5+;.
What are the key properties of butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine?
butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine has a molecular weight of 223.28 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(E)-N-methyl-3-(trifluoromethyl)pent-3-en-2-imine is sourced from PubChem (CID 178040622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).