C8H12F3N — CID 153254458
N,4-dimethyl-3-(trifluoromethyl)pent-3-en-2-imine (PubChem CID 153254458) has the molecular formula C8H12F3N and a molecular weight of 179.18 g/mol. Its IUPAC name is N,4-dimethyl-3-(trifluoromethyl)pent-3-en-2-imine.
| Compound Name | N,4-dimethyl-3-(trifluoromethyl)pent-3-en-2-imine |
|---|---|
| PubChem CID | 153254458 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N,4-dimethyl-3-(trifluoromethyl)pent-3-en-2-imine |
| SMILES | C/N=C(\C)C(=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-5(2)7(6(3)12-4)8(9,10)11/h1-4H3/b12-6+ |
| InChIKey | WTZGWKWTIRZJSF-WUXMJOGZSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|