C7H11F2N — CID 123282924
3,4-difluoro-N-methylhex-3-en-2-imine (PubChem CID 123282924) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is 3,4-difluoro-N-methylhex-3-en-2-imine.
| Compound Name | 3,4-difluoro-N-methylhex-3-en-2-imine |
|---|---|
| PubChem CID | 123282924 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 3,4-difluoro-N-methylhex-3-en-2-imine |
| SMILES | CCC(F)=C(F)/C(C)=N/C |
| InChI | InChI=1S/C7H11F2N/c1-4-6(8)7(9)5(2)10-3/h4H2,1-3H3/b7-6?,10-5+ |
| InChIKey | FIUBZBUJTJKBBL-ZKELMAFTSA-N |
| XLogP | 2.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|