C7H12FN — CID 123892315
4-fluoro-N,3-dimethylpent-3-en-2-imine (PubChem CID 123892315) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethylpent-3-en-2-imine.
| Compound Name | 4-fluoro-N,3-dimethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 123892315 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 4-fluoro-N,3-dimethylpent-3-en-2-imine |
| SMILES | C/N=C(\C)C(C)=C(C)F |
| InChI | InChI=1S/C7H12FN/c1-5(6(2)8)7(3)9-4/h1-4H3/b6-5?,9-7+ |
| InChIKey | BNKPBRLDDGZZBN-VFEDGGCQSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|