C9H14F3N — CID 143873906
(E)-1,1,1-trifluoro-N,3,4-trimethylhex-3-en-2-imine (PubChem CID 143873906) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-N,3,4-trimethylhex-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-N,3,4-trimethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 143873906 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (E)-1,1,1-trifluoro-N,3,4-trimethylhex-3-en-2-imine |
| SMILES | CC/C(C)=C(C)/C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-5-6(2)7(3)8(13-4)9(10,11)12/h5H2,1-4H3/b7-6+,13-8+ |
| InChIKey | ZJAKMNAGVJLHBM-GTTXMNNRSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|