C9H15F2N — CID 123999875
(E)-3-(1,1-difluoroethyl)-N-ethylpent-3-en-2-imine (PubChem CID 123999875) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is (E)-3-(1,1-difluoroethyl)-N-ethylpent-3-en-2-imine.
| Compound Name | (E)-3-(1,1-difluoroethyl)-N-ethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 123999875 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (E)-3-(1,1-difluoroethyl)-N-ethylpent-3-en-2-imine |
| SMILES | C/C=C(C(\C)=N\CC)/C(C)(F)F |
| InChI | InChI=1S/C9H15F2N/c1-5-8(9(4,10)11)7(3)12-6-2/h5H,6H2,1-4H3/b8-5+,12-7+ |
| InChIKey | RNQYGXWNZOMLDR-WAMUHJNZSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|