C7H9F2N — CID 89101610
(2R)-5-(difluoromethyl)-2,4-dimethyl-2H-pyrrole (PubChem CID 89101610) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is (2R)-5-(difluoromethyl)-2,4-dimethyl-2H-pyrrole.
| Compound Name | (2R)-5-(difluoromethyl)-2,4-dimethyl-2H-pyrrole |
|---|---|
| PubChem CID | 89101610 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (2R)-5-(difluoromethyl)-2,4-dimethyl-2H-pyrrole |
| SMILES | CC1=C[C@@H](C)N=C1C(F)F |
| InChI | InChI=1S/C7H9F2N/c1-4-3-5(2)10-6(4)7(8)9/h3,5,7H,1-2H3/t5-/m1/s1 |
| InChIKey | GLHRHZFITQVKFW-RXMQYKEDSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |