C8H11F4N — CID 142448493
(E)-N-ethyl-1,1,1,4-tetrafluoro-3-methylpent-3-en-2-imine (PubChem CID 142448493) has the molecular formula C8H11F4N and a molecular weight of 197.17 g/mol. Its IUPAC name is (E)-N-ethyl-1,1,1,4-tetrafluoro-3-methylpent-3-en-2-imine.
| Compound Name | (E)-N-ethyl-1,1,1,4-tetrafluoro-3-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 142448493 |
| Molecular Formula | C8H11F4N |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (E)-N-ethyl-1,1,1,4-tetrafluoro-3-methylpent-3-en-2-imine |
| SMILES | CC/N=C(C(\C)=C(/C)F)/C(F)(F)F |
| InChI | InChI=1S/C8H11F4N/c1-4-13-7(8(10,11)12)5(2)6(3)9/h4H2,1-3H3/b6-5+,13-7+ |
| InChIKey | JECPCWDHZTZXCK-WOXAVFRBSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|