C10H16F3N — CID 144800816
1,1,1-trifluoro-N,2,2,5-tetramethylhex-4-en-3-imine (PubChem CID 144800816) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-N,2,2,5-tetramethylhex-4-en-3-imine.
| Compound Name | 1,1,1-trifluoro-N,2,2,5-tetramethylhex-4-en-3-imine |
|---|---|
| PubChem CID | 144800816 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1,1,1-trifluoro-N,2,2,5-tetramethylhex-4-en-3-imine |
| SMILES | C/N=C(\C=C(C)C)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-7(2)6-8(14-5)9(3,4)10(11,12)13/h6H,1-5H3/b14-8+ |
| InChIKey | GRPSKYBNBSQXBR-RIYZIHGNSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|