C9H16F3N — CID 176921366
ethane;(Z)-1,1,1-trifluoro-N,3-dimethylpent-3-en-2-imine (PubChem CID 176921366) has the molecular formula C9H16F3N and a molecular weight of 195.23 g/mol. Its IUPAC name is ethane;(Z)-1,1,1-trifluoro-N,3-dimethylpent-3-en-2-imine.
| Compound Name | ethane;(Z)-1,1,1-trifluoro-N,3-dimethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 176921366 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | ethane;(Z)-1,1,1-trifluoro-N,3-dimethylpent-3-en-2-imine |
| SMILES | C/C=C(C)\C(=N/C)C(F)(F)F.CC |
| InChI | InChI=1S/C7H10F3N.C2H6/c1-4-5(2)6(11-3)7(8,9)10;1-2/h4H,1-3H3;1-2H3/b5-4-,11-6+; |
| InChIKey | ZRQDIYMYGVIXCK-CMTDRSDRSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|