C9H13F2N — CID 162620455
1,1-difluoro-4-methyl-N-[(E)-prop-1-enyl]pent-3-en-2-imine (PubChem CID 162620455) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is 1,1-difluoro-4-methyl-N-[(E)-prop-1-enyl]pent-3-en-2-imine.
| Compound Name | 1,1-difluoro-4-methyl-N-[(E)-prop-1-enyl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 162620455 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1,1-difluoro-4-methyl-N-[(E)-prop-1-enyl]pent-3-en-2-imine |
| SMILES | C/C=C/N=C(/C=C(C)C)C(F)F |
| InChI | InChI=1S/C9H13F2N/c1-4-5-12-8(9(10)11)6-7(2)3/h4-6,9H,1-3H3/b5-4+,12-8- |
| InChIKey | PISQGYYFZMFALF-OVWGVEBBSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|