C10H20N2 — CID 142083303
ethane;(2Z,4Z)-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-amine (PubChem CID 142083303) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;(2Z,4Z)-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-amine.
| Compound Name | ethane;(2Z,4Z)-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142083303 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | ethane;(2Z,4Z)-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-amine |
| SMILES | C=N/C(=C\C(C)=C/C)CN.CC |
| InChI | InChI=1S/C8H14N2.C2H6/c1-4-7(2)5-8(6-9)10-3;1-2/h4-5H,3,6,9H2,1-2H3;1-2H3/b7-4-,8-5-; |
| InChIKey | YSUMIJGKTFWIKN-DNNMRGOVSA-N |
| XLogP | 2.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|