C13H20FN3 — CID 137410339
(1E,4Z)-2-[(2E,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]hexa-1,4-diene-1,3-diamine (PubChem CID 137410339) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is (1E,4Z)-2-[(2E,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]hexa-1,4-diene-1,3-diamine.
| Compound Name | (1E,4Z)-2-[(2E,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]hexa-1,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 137410339 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (1E,4Z)-2-[(2E,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dien-3-yl]hexa-1,4-diene-1,3-diamine |
| SMILES | C=N/C(C)=C(\C=C(/C)F)C(=C\N)/C(N)/C=C\C |
| InChI | InChI=1S/C13H20FN3/c1-5-6-13(16)12(8-15)11(7-9(2)14)10(3)17-4/h5-8,13H,4,15-16H2,1-3H3/b6-5-,9-7+,11-10+,12-8+ |
| InChIKey | MEFXKXGDTYRUJS-UPWZQBFJSA-N |
| XLogP | 2.58 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|