About 2-(4,4-difluoroindol-3-yl)ethanamine
2-(4,4-difluoroindol-3-yl)ethanamine (PubChem CID 175941540) has the molecular formula C10H10F2N2
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(4,4-difluoroindol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,4-difluoroindol-3-yl)ethanamine |
| PubChem CID | 175941540 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(4,4-difluoroindol-3-yl)ethanamine |
| SMILES | NCCC1=C2C(=CC=CC2(F)F)N=C1 |
| InChI | InChI=1S/C10H10F2N2/c11-10(12)4-1-2-8-9(10)7(3-5-13)6-14-8/h1-2,4,6H,3,5,13H2 |
| InChIKey | YOHDLHMBJVZXHZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-difluoroindol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoroindol-3-yl)ethanamine?
The IUPAC name of 2-(4,4-difluoroindol-3-yl)ethanamine (CID 175941540) is 2-(4,4-difluoroindol-3-yl)ethanamine.
What is the SMILES notation for 2-(4,4-difluoroindol-3-yl)ethanamine?
The canonical SMILES for 2-(4,4-difluoroindol-3-yl)ethanamine is NCCC1=C2C(=CC=CC2(F)F)N=C1.
What is the InChIKey of 2-(4,4-difluoroindol-3-yl)ethanamine?
The InChIKey is YOHDLHMBJVZXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2/c11-10(12)4-1-2-8-9(10)7(3-5-13)6-14-8/h1-2,4,6H,3,5,13H2.
What are the key properties of 2-(4,4-difluoroindol-3-yl)ethanamine?
2-(4,4-difluoroindol-3-yl)ethanamine has a molecular weight of 196.20 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoroindol-3-yl)ethanamine is sourced from PubChem (CID 175941540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).