C10H10F2N2 — CID 175941540
2-(4,4-difluoroindol-3-yl)ethanamine (PubChem CID 175941540) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(4,4-difluoroindol-3-yl)ethanamine.
| Compound Name | 2-(4,4-difluoroindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 175941540 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(4,4-difluoroindol-3-yl)ethanamine |
| SMILES | NCCC1=C2C(=CC=CC2(F)F)N=C1 |
| InChI | InChI=1S/C10H10F2N2/c11-10(12)4-1-2-8-9(10)7(3-5-13)6-14-8/h1-2,4,6H,3,5,13H2 |
| InChIKey | YOHDLHMBJVZXHZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |