C18H27FIN3 — CID 163707955
(1Z,3Z,7E,9Z)-7-(dimethyl-λ3-iodanyl)-9-(ethylideneamino)-8-(1-fluoroethenyl)-6-imino-3-methylundeca-1,3,7,9-tetraen-1-amine (PubChem CID 163707955) has the molecular formula C18H27FIN3 and a molecular weight of 431.34 g/mol. Its IUPAC name is (1Z,3Z,7E,9Z)-7-(dimethyl-λ3-iodanyl)-9-(ethylideneamino)-8-(1-fluoroethenyl)-6-imino-3-methylundeca-1,3,7,9-tetraen-1-amine.
| Compound Name | (1Z,3Z,7E,9Z)-7-(dimethyl-λ3-iodanyl)-9-(ethylideneamino)-8-(1-fluoroethenyl)-6-imino-3-methylundeca-1,3,7,9-tetraen-1-amine |
|---|---|
| PubChem CID | 163707955 |
| Molecular Formula | C18H27FIN3 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (1Z,3Z,7E,9Z)-7-(dimethyl-λ3-iodanyl)-9-(ethylideneamino)-8-(1-fluoroethenyl)-6-imino-3-methylundeca-1,3,7,9-tetraen-1-amine |
| SMILES | [H]/N=C(C/C=C(C)\C=C/N)/C(=C(\C(=C)F)C(=CC)/N=C/C)I(C)C |
| InChI | InChI=1S/C18H27FIN3/c1-7-16(23-8-2)17(14(4)19)18(20(5)6)15(22)10-9-13(3)11-12-21/h7-9,11-12,22H,4,10,21H2,1-3,5-6H3/b12-11-,13-9-,16-7-,18-17-,22-15+,23-8+ |
| InChIKey | KGSBUYZFQMVZNL-AOOKYUCISA-N |
| XLogP | 5.31 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|