C16H22N4 — CID 134502439
(1E,3E,6Z)-6-ethenyl-3-[N-methyl-C-[(Z)-2-(methylideneamino)ethenyl]carbonimidoyl]nona-1,3,6,8-tetraene-1,2-diamine (PubChem CID 134502439) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is (1E,3E,6Z)-6-ethenyl-3-[N-methyl-C-[(Z)-2-(methylideneamino)ethenyl]carbonimidoyl]nona-1,3,6,8-tetraene-1,2-diamine.
| Compound Name | (1E,3E,6Z)-6-ethenyl-3-[N-methyl-C-[(Z)-2-(methylideneamino)ethenyl]carbonimidoyl]nona-1,3,6,8-tetraene-1,2-diamine |
|---|---|
| PubChem CID | 134502439 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1E,3E,6Z)-6-ethenyl-3-[N-methyl-C-[(Z)-2-(methylideneamino)ethenyl]carbonimidoyl]nona-1,3,6,8-tetraene-1,2-diamine |
| SMILES | C=C/C=C(\C=C)C/C=C(C(\N)=C/N)/C(/C=C\N=C)=N/C |
| InChI | InChI=1S/C16H22N4/c1-5-7-13(6-2)8-9-14(15(18)12-17)16(20-4)10-11-19-3/h5-7,9-12H,1-3,8,17-18H2,4H3/b11-10-,13-7+,14-9+,15-12+,20-16+ |
| InChIKey | UKUFAKXDENFOPK-YRXPEWCOSA-N |
| XLogP | 2.65 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|