C16H24N2 — CID 123885176
(4E,6E)-3-N-ethyl-2,6-dimethyl-4-N-propan-2-ylidenenona-1,4,6,8-tetraene-3,4-diimine (PubChem CID 123885176) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (4E,6E)-3-N-ethyl-2,6-dimethyl-4-N-propan-2-ylidenenona-1,4,6,8-tetraene-3,4-diimine.
| Compound Name | (4E,6E)-3-N-ethyl-2,6-dimethyl-4-N-propan-2-ylidenenona-1,4,6,8-tetraene-3,4-diimine |
|---|---|
| PubChem CID | 123885176 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (4E,6E)-3-N-ethyl-2,6-dimethyl-4-N-propan-2-ylidenenona-1,4,6,8-tetraene-3,4-diimine |
| SMILES | C=C/C=C(C)/C=C(N=C(C)C)\C(=N\CC)C(=C)C |
| InChI | InChI=1S/C16H24N2/c1-8-10-14(7)11-15(18-13(5)6)16(12(3)4)17-9-2/h8,10-11H,1,3,9H2,2,4-7H3/b14-10+,15-11+,17-16+ |
| InChIKey | FFPGBDJQHUJJJM-TVEUDMMXSA-N |
| XLogP | 4.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|