C18H28N2 — CID 90804107
N-(3-ethyl-7-hexyl-2H-azepin-5-yl)but-3-en-2-imine (PubChem CID 90804107) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-(3-ethyl-7-hexyl-2H-azepin-5-yl)but-3-en-2-imine.
| Compound Name | N-(3-ethyl-7-hexyl-2H-azepin-5-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 90804107 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-(3-ethyl-7-hexyl-2H-azepin-5-yl)but-3-en-2-imine |
| SMILES | C=C/C(C)=N/C1=CC(CCCCCC)=NCC(CC)=C1 |
| InChI | InChI=1S/C18H28N2/c1-5-8-9-10-11-17-13-18(20-15(4)6-2)12-16(7-3)14-19-17/h6,12-13H,2,5,7-11,14H2,1,3-4H3/b20-15+ |
| InChIKey | FCRWWSVRCQZDRP-HMMYKYKNSA-N |
| XLogP | 5.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|