C17H20N2 — CID 123146075
(3E)-3-but-3-enylidene-4,6,9-trimethyl-2,5-diazabicyclo[5.5.0]dodeca-1,4,6,9,11-pentaene (PubChem CID 123146075) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (3E)-3-but-3-enylidene-4,6,9-trimethyl-2,5-diazabicyclo[5.5.0]dodeca-1,4,6,9,11-pentaene.
| Compound Name | (3E)-3-but-3-enylidene-4,6,9-trimethyl-2,5-diazabicyclo[5.5.0]dodeca-1,4,6,9,11-pentaene |
|---|---|
| PubChem CID | 123146075 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (3E)-3-but-3-enylidene-4,6,9-trimethyl-2,5-diazabicyclo[5.5.0]dodeca-1,4,6,9,11-pentaene |
| SMILES | C=CC/C=C1/N=C2C=CC=C(C)CC2=C(C)N=C1C |
| InChI | InChI=1S/C17H20N2/c1-5-6-9-16-14(4)18-13(3)15-11-12(2)8-7-10-17(15)19-16/h5,7-10H,1,6,11H2,2-4H3/b16-9+ |
| InChIKey | KJBCOEUPGZTFBT-CXUHLZMHSA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|