C12H15N — CID 90261573
2-[(3E)-hepta-1,3-dien-4-yl]-5-methylidenepyrrole (PubChem CID 90261573) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(3E)-hepta-1,3-dien-4-yl]-5-methylidenepyrrole.
| Compound Name | 2-[(3E)-hepta-1,3-dien-4-yl]-5-methylidenepyrrole |
|---|---|
| PubChem CID | 90261573 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-[(3E)-hepta-1,3-dien-4-yl]-5-methylidenepyrrole |
| SMILES | C=C/C=C(\CCC)C1=NC(=C)C=C1 |
| InChI | InChI=1S/C12H15N/c1-4-6-11(7-5-2)12-9-8-10(3)13-12/h4,6,8-9H,1,3,5,7H2,2H3/b11-6+ |
| InChIKey | ICUOALOENJLVFR-IZZDOVSWSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|