C13H19N — CID 123621954
N-(6-ethylcyclohepta-1,3,6-trien-1-yl)butan-2-imine (PubChem CID 123621954) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-(6-ethylcyclohepta-1,3,6-trien-1-yl)butan-2-imine.
| Compound Name | N-(6-ethylcyclohepta-1,3,6-trien-1-yl)butan-2-imine |
|---|---|
| PubChem CID | 123621954 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-(6-ethylcyclohepta-1,3,6-trien-1-yl)butan-2-imine |
| SMILES | CCC1=CC(/N=C(\C)CC)=CC=CC1 |
| InChI | InChI=1S/C13H19N/c1-4-11(3)14-13-9-7-6-8-12(5-2)10-13/h6-7,9-10H,4-5,8H2,1-3H3/b14-11+ |
| InChIKey | HXULUTHWTUWUIT-SDNWHVSQSA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|