C17H22FN — CID 143722000
1-(3-fluoro-5-methylcyclohepta-1,3,6-trien-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]ethanimine (PubChem CID 143722000) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(3-fluoro-5-methylcyclohepta-1,3,6-trien-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]ethanimine.
| Compound Name | 1-(3-fluoro-5-methylcyclohepta-1,3,6-trien-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]ethanimine |
|---|---|
| PubChem CID | 143722000 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(3-fluoro-5-methylcyclohepta-1,3,6-trien-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]ethanimine |
| SMILES | C=C(CC)C(=C/C)/N=C(\C)C1=CC(F)=CC(C)C=C1 |
| InChI | InChI=1S/C17H22FN/c1-6-13(4)17(7-2)19-14(5)15-9-8-12(3)10-16(18)11-15/h7-12H,4,6H2,1-3,5H3/b17-7-,19-14+ |
| InChIKey | HIHWMYCADONTHN-FBMVDENZSA-N |
| XLogP | 5.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|