C17H26F3N — CID 153345353
N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentan-2-imine (PubChem CID 153345353) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentan-2-imine.
| Compound Name | N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentan-2-imine |
|---|---|
| PubChem CID | 153345353 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]pentan-2-imine |
| SMILES | CCC/C=C(C)/C(=C\C=C(/C)C(F)(F)F)/N=C(\C)CCC |
| InChI | InChI=1S/C17H26F3N/c1-6-8-10-13(3)16(21-15(5)9-7-2)12-11-14(4)17(18,19)20/h10-12H,6-9H2,1-5H3/b13-10+,14-11+,16-12+,21-15+ |
| InChIKey | ODDZDNNPKDMXIY-JQRKNAESSA-N |
| XLogP | 6.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|