C20H23BrF3N — CID 129043804
(3E,4E)-N-[(2E,4Z)-6-bromo-4-methylhepta-2,4,6-trien-3-yl]-3-ethylidene-1,1,1-trifluoro-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-imine (PubChem CID 129043804) has the molecular formula C20H23BrF3N and a molecular weight of 414.31 g/mol. Its IUPAC name is (3E,4E)-N-[(2E,4Z)-6-bromo-4-methylhepta-2,4,6-trien-3-yl]-3-ethylidene-1,1,1-trifluoro-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-imine.
| Compound Name | (3E,4E)-N-[(2E,4Z)-6-bromo-4-methylhepta-2,4,6-trien-3-yl]-3-ethylidene-1,1,1-trifluoro-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 129043804 |
| Molecular Formula | C20H23BrF3N |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (3E,4E)-N-[(2E,4Z)-6-bromo-4-methylhepta-2,4,6-trien-3-yl]-3-ethylidene-1,1,1-trifluoro-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-imine |
| SMILES | C=C/C=C(\C=C/C)C(=C\C)/C(=N/C(=C/C)/C(C)=C\C(=C)Br)C(F)(F)F |
| InChI | InChI=1S/C20H23BrF3N/c1-7-11-16(12-8-2)17(9-3)19(20(22,23)24)25-18(10-4)14(5)13-15(6)21/h7-13H,1,6H2,2-5H3/b12-8-,14-13-,16-11+,17-9+,18-10+,25-19- |
| InChIKey | CHQHLKPBDCRXTM-OXYVFZDTSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|