C17H22F3N — CID 143460151
2-tert-butyl-5-[(2E,4E,6Z)-5-(trifluoromethyl)octa-2,4,6-trien-2-yl]-3H-pyrrole (PubChem CID 143460151) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2E,4E,6Z)-5-(trifluoromethyl)octa-2,4,6-trien-2-yl]-3H-pyrrole.
| Compound Name | 2-tert-butyl-5-[(2E,4E,6Z)-5-(trifluoromethyl)octa-2,4,6-trien-2-yl]-3H-pyrrole |
|---|---|
| PubChem CID | 143460151 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-tert-butyl-5-[(2E,4E,6Z)-5-(trifluoromethyl)octa-2,4,6-trien-2-yl]-3H-pyrrole |
| SMILES | C/C=C\C(=C/C=C(\C)C1=CCC(C(C)(C)C)=N1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3N/c1-6-7-13(17(18,19)20)9-8-12(2)14-10-11-15(21-14)16(3,4)5/h6-10H,11H2,1-5H3/b7-6-,12-8+,13-9+ |
| InChIKey | IFPRCJFRARSXDJ-CYAJVYQESA-N |
| XLogP | 5.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|