C19H27N — CID 170359947
N-[(3Z,5E)-5-ethenyldeca-1,3,5,9-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine (PubChem CID 170359947) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-[(3Z,5E)-5-ethenyldeca-1,3,5,9-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine.
| Compound Name | N-[(3Z,5E)-5-ethenyldeca-1,3,5,9-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine |
|---|---|
| PubChem CID | 170359947 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-[(3Z,5E)-5-ethenyldeca-1,3,5,9-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine |
| SMILES | C=C/C=C(\N=C(/C=C)C(C)(C)C)C(C=C)=CCCC=C |
| InChI | InChI=1S/C19H27N/c1-8-12-13-15-16(10-3)17(14-9-2)20-18(11-4)19(5,6)7/h8-11,14-15H,1-4,12-13H2,5-7H3/b16-15+,17-14-,20-18+ |
| InChIKey | LMKGYOLCCHASMO-JZAXUSRTSA-N |
| XLogP | 5.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|