C16H26N2 — CID 102291686
(3Z,7Z)-2,6-ditert-butyl-4,8-dimethyl-1,5-diazocine (PubChem CID 102291686) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3Z,7Z)-2,6-ditert-butyl-4,8-dimethyl-1,5-diazocine.
| Compound Name | (3Z,7Z)-2,6-ditert-butyl-4,8-dimethyl-1,5-diazocine |
|---|---|
| PubChem CID | 102291686 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (3Z,7Z)-2,6-ditert-butyl-4,8-dimethyl-1,5-diazocine |
| SMILES | CC1=C/C(C(C)(C)C)=N\C(C)=C/C(C(C)(C)C)=N\1 |
| InChI | InChI=1S/C16H26N2/c1-11-9-13(15(3,4)5)18-12(2)10-14(17-11)16(6,7)8/h9-10H,1-8H3/b11-9-,12-10-,13-9-,14-10-,17-11-,17-14+,18-12-,18-13+ |
| InChIKey | MFOMJGFNOXQEHJ-HKMASHIGSA-N |
| XLogP | 4.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |