C22H38N2 — CID 102291687
(3Z,7Z)-4,8-dibutyl-2,6-ditert-butyl-1,5-diazocine (PubChem CID 102291687) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is (3Z,7Z)-4,8-dibutyl-2,6-ditert-butyl-1,5-diazocine.
| Compound Name | (3Z,7Z)-4,8-dibutyl-2,6-ditert-butyl-1,5-diazocine |
|---|---|
| PubChem CID | 102291687 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | (3Z,7Z)-4,8-dibutyl-2,6-ditert-butyl-1,5-diazocine |
| SMILES | CCCCC1=C/C(C(C)(C)C)=N\C(CCCC)=C/C(C(C)(C)C)=N\1 |
| InChI | InChI=1S/C22H38N2/c1-9-11-13-17-15-19(21(3,4)5)24-18(14-12-10-2)16-20(23-17)22(6,7)8/h15-16H,9-14H2,1-8H3/b17-15-,18-16-,19-15-,20-16-,23-17-,23-20+,24-18-,24-19+ |
| InChIKey | YUGGJBIZCNNQFF-LXHHTPKTSA-N |
| XLogP | 7.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |