C16H29N — CID 142361065
(Z)-N-(4,4-dimethylpent-1-en-2-yl)-6,6-dimethylhept-2-en-4-imine (PubChem CID 142361065) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (Z)-N-(4,4-dimethylpent-1-en-2-yl)-6,6-dimethylhept-2-en-4-imine.
| Compound Name | (Z)-N-(4,4-dimethylpent-1-en-2-yl)-6,6-dimethylhept-2-en-4-imine |
|---|---|
| PubChem CID | 142361065 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (Z)-N-(4,4-dimethylpent-1-en-2-yl)-6,6-dimethylhept-2-en-4-imine |
| SMILES | C=C(CC(C)(C)C)/N=C(\C=C/C)CC(C)(C)C |
| InChI | InChI=1S/C16H29N/c1-9-10-14(12-16(6,7)8)17-13(2)11-15(3,4)5/h9-10H,2,11-12H2,1,3-8H3/b10-9-,17-14+ |
| InChIKey | DDMGQSLHDXTBGR-YNMXRFAKSA-N |
| XLogP | 5.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|