C19H31N — CID 123610926
N-(3,7-dimethylocta-4,6-dien-4-yl)-4,6,6-trimethylcyclohex-2-en-1-imine (PubChem CID 123610926) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is N-(3,7-dimethylocta-4,6-dien-4-yl)-4,6,6-trimethylcyclohex-2-en-1-imine.
| Compound Name | N-(3,7-dimethylocta-4,6-dien-4-yl)-4,6,6-trimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123610926 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-(3,7-dimethylocta-4,6-dien-4-yl)-4,6,6-trimethylcyclohex-2-en-1-imine |
| SMILES | CCC(C)C(=CC=C(C)C)/N=C1\C=CC(C)CC1(C)C |
| InChI | InChI=1S/C19H31N/c1-8-16(5)17(11-9-14(2)3)20-18-12-10-15(4)13-19(18,6)7/h9-12,15-16H,8,13H2,1-7H3/b17-11?,20-18+ |
| InChIKey | HLGNDLWKFBZMMI-VGLNNBEXSA-N |
| XLogP | 5.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|