C19H21N — CID 87320214
2-but-2-enyl-2,3,4-trimethylcarbazole (PubChem CID 87320214) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-but-2-enyl-2,3,4-trimethylcarbazole.
| Compound Name | 2-but-2-enyl-2,3,4-trimethylcarbazole |
|---|---|
| PubChem CID | 87320214 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-but-2-enyl-2,3,4-trimethylcarbazole |
| SMILES | CC=CCC1(C)C=C2N=c3ccccc3=C2C(C)=C1C |
| InChI | InChI=1S/C19H21N/c1-5-6-11-19(4)12-17-18(13(2)14(19)3)15-9-7-8-10-16(15)20-17/h5-10,12H,11H2,1-4H3 |
| InChIKey | MEURTEKKIBZNIG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|