C11H12KN — CID 58220092
potassium 2,3,3-trimethyl-5H-indol-5-ide (PubChem CID 58220092) has the molecular formula C11H12KN and a molecular weight of 197.32 g/mol. Its IUPAC name is potassium 2,3,3-trimethyl-5H-indol-5-ide.
| Compound Name | potassium 2,3,3-trimethyl-5H-indol-5-ide |
|---|---|
| PubChem CID | 58220092 |
| Molecular Formula | C11H12KN |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | potassium 2,3,3-trimethyl-5H-indol-5-ide |
| SMILES | CC1=Nc2cc[c-]cc2C1(C)C.[K+] |
| InChI | InChI=1S/C11H12N.K/c1-8-11(2,3)9-6-4-5-7-10(9)12-8;/h5-7H,1-3H3;/q-1;+1 |
| InChIKey | GOBGAYJHCMTZJJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|