C20H13N — CID 20512480
21-azapentacyclo[12.7.0.02,7.07,12.015,20]henicosa-1,3,5,8,10,12,14,16,18,20-decaene (PubChem CID 20512480) has the molecular formula C20H13N and a molecular weight of 267.33 g/mol. Its IUPAC name is 21-azapentacyclo[12.7.0.02,7.07,12.015,20]henicosa-1,3,5,8,10,12,14,16,18,20-decaene.
| Compound Name | 21-azapentacyclo[12.7.0.02,7.07,12.015,20]henicosa-1,3,5,8,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 20512480 |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 21-azapentacyclo[12.7.0.02,7.07,12.015,20]henicosa-1,3,5,8,10,12,14,16,18,20-decaene |
| SMILES | C1=CC2=CC3=c4ccccc4=NC3=C3C=CC=CC23C=C1 |
| InChI | InChI=1S/C20H13N/c1-2-10-18-15(8-1)16-13-14-7-3-5-11-20(14)12-6-4-9-17(20)19(16)21-18/h1-13H |
| InChIKey | CUGNEXJJWSDHTI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |