C14H9N — CID 54107119
15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(15),2,4,6,8,11,13-heptaene (PubChem CID 54107119) has the molecular formula C14H9N and a molecular weight of 191.23 g/mol. Its IUPAC name is 15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(15),2,4,6,8,11,13-heptaene.
| Compound Name | 15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(15),2,4,6,8,11,13-heptaene |
|---|---|
| PubChem CID | 54107119 |
| Molecular Formula | C14H9N |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(15),2,4,6,8,11,13-heptaene |
| SMILES | C1=C2N=c3cccc4ccc(c2c34)=CC1 |
| InChI | InChI=1S/C14H9N/c1-3-9-7-8-10-4-2-6-12-14(10)13(9)11(5-1)15-12/h1,3-8H,2H2 |
| InChIKey | NENBBNCEYUJHDW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |