C11H22N2 — CID 72560394
N,N,5,5-tetramethyl-4-methyliminohex-2-en-2-amine (PubChem CID 72560394) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N,N,5,5-tetramethyl-4-methyliminohex-2-en-2-amine.
| Compound Name | N,N,5,5-tetramethyl-4-methyliminohex-2-en-2-amine |
|---|---|
| PubChem CID | 72560394 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N,N,5,5-tetramethyl-4-methyliminohex-2-en-2-amine |
| SMILES | C/N=C(\C=C(C)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-9(13(6)7)8-10(12-5)11(2,3)4/h8H,1-7H3/b9-8?,12-10+ |
| InChIKey | SNQHOEHRTYPFNN-HYSGBWKPSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|