C13H24N2 — CID 88945024
(3Z)-N,N,2,6,6-pentamethyl-5-methyliminohepta-1,3-dien-3-amine (PubChem CID 88945024) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (3Z)-N,N,2,6,6-pentamethyl-5-methyliminohepta-1,3-dien-3-amine.
| Compound Name | (3Z)-N,N,2,6,6-pentamethyl-5-methyliminohepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 88945024 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (3Z)-N,N,2,6,6-pentamethyl-5-methyliminohepta-1,3-dien-3-amine |
| SMILES | C=C(C)/C(=C/C(=N/C)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C13H24N2/c1-10(2)11(15(7)8)9-12(14-6)13(3,4)5/h9H,1H2,2-8H3/b11-9-,14-12- |
| InChIKey | IURURMHVYXOFMF-YJKQCFOZSA-N |
| XLogP | 3.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|