C14H24N2 — CID 123335275
N,3-dimethyl-5-methylidene-N-(2-methyliminopropyl)hepta-1,3-dien-2-amine (PubChem CID 123335275) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,3-dimethyl-5-methylidene-N-(2-methyliminopropyl)hepta-1,3-dien-2-amine.
| Compound Name | N,3-dimethyl-5-methylidene-N-(2-methyliminopropyl)hepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 123335275 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,3-dimethyl-5-methylidene-N-(2-methyliminopropyl)hepta-1,3-dien-2-amine |
| SMILES | C=C(C=C(C)C(=C)N(C)C/C(C)=N/C)CC |
| InChI | InChI=1S/C14H24N2/c1-8-11(2)9-12(3)14(5)16(7)10-13(4)15-6/h9H,2,5,8,10H2,1,3-4,6-7H3/b12-9?,15-13+ |
| InChIKey | RJJWPUDKNMRIPG-GBRAQZIQSA-N |
| XLogP | 3.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|