C12H21N — CID 91370009
N-[(2E)-4-methylocta-2,4-dien-3-yl]propan-2-imine (PubChem CID 91370009) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-[(2E)-4-methylocta-2,4-dien-3-yl]propan-2-imine.
| Compound Name | N-[(2E)-4-methylocta-2,4-dien-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 91370009 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-[(2E)-4-methylocta-2,4-dien-3-yl]propan-2-imine |
| SMILES | C/C=C(/N=C(C)C)C(C)=CCCC |
| InChI | InChI=1S/C12H21N/c1-6-8-9-11(5)12(7-2)13-10(3)4/h7,9H,6,8H2,1-5H3/b11-9?,12-7+ |
| InChIKey | XNTJMBWRKAZHPU-MGMHGTPKSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|