C14H22N+ — CID 123659364
ethyl-hexa-2,4-dien-3-yl-hexa-3,5-dien-2-ylideneazanium (PubChem CID 123659364) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is ethyl-hexa-2,4-dien-3-yl-hexa-3,5-dien-2-ylideneazanium.
| Compound Name | ethyl-hexa-2,4-dien-3-yl-hexa-3,5-dien-2-ylideneazanium |
|---|---|
| PubChem CID | 123659364 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethyl-hexa-2,4-dien-3-yl-hexa-3,5-dien-2-ylideneazanium |
| SMILES | C=CC=C/C(C)=[N+](\CC)C(C=CC)=CC |
| InChI | InChI=1S/C14H22N/c1-6-10-12-13(5)15(9-4)14(8-3)11-7-2/h6-8,10-12H,1,9H2,2-5H3/q+1/b11-7?,12-10?,14-8?,15-13+ |
| InChIKey | FPPIHZYPZBKSNH-UPLRFXNISA-N |
| XLogP | 3.70 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|