C14H22N2Zn — CID 11543752
zinc;carbanide;propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide (PubChem CID 11543752) has the molecular formula C14H22N2Zn and a molecular weight of 283.73 g/mol. Its IUPAC name is zinc;carbanide;propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide.
| Compound Name | zinc;carbanide;propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide |
|---|---|
| PubChem CID | 11543752 |
| Molecular Formula | C14H22N2Zn |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | zinc;carbanide;propan-2-yl-(7-propan-2-yliminocyclohepta-1,3,5-trien-1-yl)azanide |
| SMILES | CC(C)/N=c1\cccccc1[N-]C(C)C.[CH3-].[Zn+2] |
| InChI | InChI=1S/C13H19N2.CH3.Zn/c1-10(2)14-12-8-6-5-7-9-13(12)15-11(3)4;;/h5-11H,1-4H3;1H3;/q2*-1;+2 |
| InChIKey | VKMONPMPLRUQQX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|