C13H20N2 — CID 5241766
N-propyl-7-propyliminocyclohepta-1,3,5-trien-1-amine (PubChem CID 5241766) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-propyl-7-propyliminocyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-propyl-7-propyliminocyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 5241766 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-propyl-7-propyliminocyclohepta-1,3,5-trien-1-amine |
| SMILES | CCC/N=c1\cccccc1NCCC |
| InChI | InChI=1S/C13H20N2/c1-3-10-14-12-8-6-5-7-9-13(12)15-11-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,14,15) |
| InChIKey | TVHBQNFMJFQSGY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |