C17H28N2 — CID 91049889
N-ethyl-N-hexa-1,5-dien-2-yl-6-(propan-2-ylideneamino)hexa-2,4-dien-1-amine (PubChem CID 91049889) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-ethyl-N-hexa-1,5-dien-2-yl-6-(propan-2-ylideneamino)hexa-2,4-dien-1-amine.
| Compound Name | N-ethyl-N-hexa-1,5-dien-2-yl-6-(propan-2-ylideneamino)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 91049889 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-ethyl-N-hexa-1,5-dien-2-yl-6-(propan-2-ylideneamino)hexa-2,4-dien-1-amine |
| SMILES | C=CCCC(=C)N(CC)CC=CC=CCN=C(C)C |
| InChI | InChI=1S/C17H28N2/c1-6-8-13-17(5)19(7-2)15-12-10-9-11-14-18-16(3)4/h6,9-12H,1,5,7-8,13-15H2,2-4H3 |
| InChIKey | FBZNUBCKYKWXTI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|