C8H12N+ — CID 90949451
1,3,5-trimethyl-2-methylidenepyrrol-1-ium (PubChem CID 90949451) has the molecular formula C8H12N+ and a molecular weight of 122.19 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-methylidenepyrrol-1-ium.
| Compound Name | 1,3,5-trimethyl-2-methylidenepyrrol-1-ium |
|---|---|
| PubChem CID | 90949451 |
| Molecular Formula | C8H12N+ |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | 1,3,5-trimethyl-2-methylidenepyrrol-1-ium |
| SMILES | C=C1C(C)=CC(C)=[N+]1C |
| InChI | InChI=1S/C8H12N/c1-6-5-7(2)9(4)8(6)3/h5H,3H2,1-2,4H3/q+1 |
| InChIKey | UGSDWFGTYJBYOV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|