C19H27N2+ — CID 59908601
1,3,3-trimethyl-2-[5-(1,3,3-trimethylpyrrol-1-ium-2-yl)penta-2,4-dienylidene]pyrrole (PubChem CID 59908601) has the molecular formula C19H27N2+ and a molecular weight of 283.44 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[5-(1,3,3-trimethylpyrrol-1-ium-2-yl)penta-2,4-dienylidene]pyrrole.
| Compound Name | 1,3,3-trimethyl-2-[5-(1,3,3-trimethylpyrrol-1-ium-2-yl)penta-2,4-dienylidene]pyrrole |
|---|---|
| PubChem CID | 59908601 |
| Molecular Formula | C19H27N2+ |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | 1,3,3-trimethyl-2-[5-(1,3,3-trimethylpyrrol-1-ium-2-yl)penta-2,4-dienylidene]pyrrole |
| SMILES | CN1C=CC(C)(C)C1=CC=CC=CC1=[N+](C)C=CC1(C)C |
| InChI | InChI=1S/C19H27N2/c1-18(2)12-14-20(5)16(18)10-8-7-9-11-17-19(3,4)13-15-21(17)6/h7-15H,1-6H3/q+1 |
| InChIKey | AIRLKKZIGRBEJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|