C18H27N2+ — CID 59890754
[2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium (PubChem CID 59890754) has the molecular formula C18H27N2+ and a molecular weight of 271.43 g/mol. Its IUPAC name is [2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium.
| Compound Name | [2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium |
|---|---|
| PubChem CID | 59890754 |
| Molecular Formula | C18H27N2+ |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | [2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium |
| SMILES | CC=C1CCC(=CC=C2N(C)C=CC2(C)C)C1=[N+](C)C |
| InChI | InChI=1S/C18H27N2/c1-7-14-8-9-15(17(14)19(4)5)10-11-16-18(2,3)12-13-20(16)6/h7,10-13H,8-9H2,1-6H3/q+1 |
| InChIKey | VGKQKWOQOGHAAN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|