C24H37N2+ — CID 160921642
1,3,3-trimethyl-2-[(3Z)-3,4,5-trimethyl-7-(1,3,3-trimethyl-2H-pyrrol-2-yl)hepta-1,3,5-trienyl]pyrrol-1-ium (PubChem CID 160921642) has the molecular formula C24H37N2+ and a molecular weight of 353.57 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(3Z)-3,4,5-trimethyl-7-(1,3,3-trimethyl-2H-pyrrol-2-yl)hepta-1,3,5-trienyl]pyrrol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-[(3Z)-3,4,5-trimethyl-7-(1,3,3-trimethyl-2H-pyrrol-2-yl)hepta-1,3,5-trienyl]pyrrol-1-ium |
|---|---|
| PubChem CID | 160921642 |
| Molecular Formula | C24H37N2+ |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | 1,3,3-trimethyl-2-[(3Z)-3,4,5-trimethyl-7-(1,3,3-trimethyl-2H-pyrrol-2-yl)hepta-1,3,5-trienyl]pyrrol-1-ium |
| SMILES | CC(=CCC1N(C)C=CC1(C)C)/C(C)=C(/C)C=CC1=[N+](C)C=CC1(C)C |
| InChI | InChI=1S/C24H37N2/c1-18(10-12-21-23(4,5)14-16-25(21)8)20(3)19(2)11-13-22-24(6,7)15-17-26(22)9/h10-12,14-17,22H,13H2,1-9H3/q+1/b12-10?,19-11?,20-18- |
| InChIKey | ASBGZJIWYUWYIS-MVSTXLATSA-N |
| XLogP | 5.71 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|