C27H42N3+ — CID 159399390
2-ethylidene-1,3,3-trimethylpyrrole;[2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium (PubChem CID 159399390) has the molecular formula C27H42N3+ and a molecular weight of 408.65 g/mol. Its IUPAC name is 2-ethylidene-1,3,3-trimethylpyrrole;[2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium.
| Compound Name | 2-ethylidene-1,3,3-trimethylpyrrole;[2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium |
|---|---|
| PubChem CID | 159399390 |
| Molecular Formula | C27H42N3+ |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 2-ethylidene-1,3,3-trimethylpyrrole;[2-ethylidene-5-[2-(1,3,3-trimethylpyrrol-2-ylidene)ethylidene]cyclopentylidene]-dimethylazanium |
| SMILES | CC=C1CCC(=CC=C2N(C)C=CC2(C)C)C1=[N+](C)C.CC=C1N(C)C=CC1(C)C |
| InChI | InChI=1S/C18H27N2.C9H15N/c1-7-14-8-9-15(17(14)19(4)5)10-11-16-18(2,3)12-13-20(16)6;1-5-8-9(2,3)6-7-10(8)4/h7,10-13H,8-9H2,1-6H3;5-7H,1-4H3/q+1; |
| InChIKey | LNDKKKJKPWKXPK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|