C23H42N2+2 — CID 123264729
[2-(4,4-dimethylpentylidene)-5-methyl-1-propan-2-yl-1-propylpyrrol-1-ium-3-ylidene]-ethenyl-propylazanium (PubChem CID 123264729) has the molecular formula C23H42N2+2 and a molecular weight of 346.60 g/mol. Its IUPAC name is [2-(4,4-dimethylpentylidene)-5-methyl-1-propan-2-yl-1-propylpyrrol-1-ium-3-ylidene]-ethenyl-propylazanium.
| Compound Name | [2-(4,4-dimethylpentylidene)-5-methyl-1-propan-2-yl-1-propylpyrrol-1-ium-3-ylidene]-ethenyl-propylazanium |
|---|---|
| PubChem CID | 123264729 |
| Molecular Formula | C23H42N2+2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | [2-(4,4-dimethylpentylidene)-5-methyl-1-propan-2-yl-1-propylpyrrol-1-ium-3-ylidene]-ethenyl-propylazanium |
| SMILES | C=C/[N+](CCC)=C1/C=C(C)[N+](CCC)(C(C)C)C1=CCCC(C)(C)C |
| InChI | InChI=1S/C23H42N2/c1-10-16-24(12-3)21-18-20(6)25(17-11-2,19(4)5)22(21)14-13-15-23(7,8)9/h12,14,18-19H,3,10-11,13,15-17H2,1-2,4-9H3/q+2/b22-14?,24-21+ |
| InChIKey | JHZXKQJKJAFNGE-WOHLRVEQSA-N |
| XLogP | 6.26 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|